octyl heptanoate


octyl heptanoate
Links:📏 NIST, 🕷 ChemSpider
CAS RN:[5132-75-2]
Formula:C15H30O2; 242.40 g/mol
InChiKey:XAZROQGRFWCMBU-UHFFFAOYSA-N
SMILES:CCCCCCCCOC(=O)CCCCCC
Molecular structure of octyl heptanoate
Melting point:-23 °C

Isomers

(ethoxymethoxy)cyclododecane
Molecular structure of (ethoxymethoxy)cyclododecane
ethyl tridecanoate
Molecular structure of ethyl tridecanoate
heptyl octanoate
Molecular structure of heptyl octanoate
methyl tetradecanoate
Molecular structure of methyl tetradecanoate
octyl heptanoate
Molecular structure of octyl heptanoate
pentadecanoic acid
Molecular structure of pentadecanoic acid
propan-2-yl dodecanoate
Molecular structure of propan-2-yl dodecanoate
propyl dodecanoate
Molecular structure of propyl dodecanoate